CAS 15996-85-7 appears in our catalog under these names: 1-[4-(trifluoromethyl)phenyl]ethanamine hydrochloride, 95%, 1–(4–(Trifluoromethyl)phenyl)ethanamine hydrochloride, 1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95%, 1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 15996-85-7) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: JVLWNYKROJNLAS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | JVLWNYKROJNLAS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)