CAS 865815-07-2 appears in our catalog under these names: (R)–1–(2–(Trifluoromethyl)phenyl)ethanamine hydrochloride, (R)-1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, (R)-1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 98%, (R)-1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 98%, 98%. Offered by: GLPBio, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 865815-07-2) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1R)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: RSQQUJNUAPWZKX-FYZOBXCZSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1R)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | RSQQUJNUAPWZKX-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=CC=C1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)