CAS 39959-68-7 appears in our catalog under these names: 1-[2-(Trifluoromethyl)phenyl]ethylamine hydrochloride, 97%, 1–(2–(Trifluoromethyl)phenyl)ethylamine Hydrochloride, 1-(2-(Trifluoromethyl)phenyl)ethylamine hydrochloride, 1-[2-(Trifluoromethyl)phenyl]ethylamine, HCl, >97%, >97%, 1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g.
1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 39959-68-7) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: RSQQUJNUAPWZKX-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | RSQQUJNUAPWZKX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)