CAS 856645-99-3 appears in our catalog under these names: (R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 97%, (R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, (R)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 2,5g, 100mg.
(1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 856645-99-3) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: JVLWNYKROJNLAS-FYZOBXCZSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1R)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | JVLWNYKROJNLAS-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)