CAS 865815-09-4 appears in our catalog under these names: (S)-1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, (S)-1-(2-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95+%, 95+%, (S)-1-[2-(Trifluoromethyl)phenyl]ethylamine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g.
(1S)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 865815-09-4) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1S)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: RSQQUJNUAPWZKX-RGMNGODLSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1S)-1-[2-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | RSQQUJNUAPWZKX-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)