CAS 141029-17-6 is the registry number for 3-(Trifluoromethyl)phenethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 141029-17-6) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: KAFOPDIMPZSSTF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 2-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | KAFOPDIMPZSSTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCN.Cl |
Computed by PubChem (NCBI)