CAS 3803-25-6 appears in our catalog under these names: 1-(3-Trifluoromethylphenyl)ethanamine hydrochloride, 98%, 1–(3–(Trifluoromethyl)phenyl)ethanamine hydrochloride, 1-(3-Trifluoromethylphenyl)ethanamine hydrochloride, 1-(3-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g.
1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 3803-25-6) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: XJVAGOCFOAYRDT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | XJVAGOCFOAYRDT-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)