cas: 843608-46-8 — see every product listed under this CAS number, including other names
(R)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine, 97%, 97% (CAS 843608-46-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119IET-50mg |
| cas | 843608-46-8 |
| size | 50mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 2373.20 Pln | |
| Chemat | 10g | 4038.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-46-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br |
Computed by PubChem (NCBI)