cas: 843608-46-8 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,2,2-trifluoroethanamine 98% (CAS 843608-46-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A512943-100mg |
| cas | 843608-46-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1049.00 Pln | |
| Ambeed | 5g | 3079.31 Pln | |
| Ambeed | 10g | 5193.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A512943 |
1-(4-bromophenyl)-2,2,2-trifluoroethanamine (CAS 843608-46-8) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZUFCCCNTJRQNCF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZUFCCCNTJRQNCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)Br |
Computed by PubChem (NCBI)