cas: 1253790-80-5 — see every product listed under this CAS number, including other names
(R)-1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride 98% (CAS 1253790-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208602-100mg |
| cas | 1253790-80-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 3524.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A208602 |
(1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride (CAS 1253790-80-5) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: (1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: SPEWNMFCSPYCCJ-NUBCRITNSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | (1R)-1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | SPEWNMFCSPYCCJ-NUBCRITNSA-N |
| SMILES | C[C@H](C1=CC(=C(C=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)