CAS 2089377-68-2 appears in our catalog under these names: 1-(4-Chloro-3- fluorophenyl)ethanamine hydrochloride, 97%, 97%, 1-(4-Chloro-3-fluorophenyl)ethanamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 10g, 1g.
1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride (CAS 2089377-68-2) is a chemical compound with the molecular formula C8H10Cl2FN and a molecular weight of 210.07 g/mol. IUPAC name: 1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: SPEWNMFCSPYCCJ-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl2FN |
|---|---|
| Molecular weight | 210.07 g/mol |
| IUPAC name | 1-(4-chloro-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | SPEWNMFCSPYCCJ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)