cas: 82572-04-1 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-1-yl)ethanamine (hydrochloride), 99.95% (CAS 82572-04-1) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g, 500 mg, 250 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-76965-10 g |
| cas | 82572-04-1 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1248.49 Pln | |
| MedChemExpress | 5 g | 839.82 Pln | |
| MedChemExpress | 500 mg | 301.12 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 407.93 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.95% |
(1R)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 82572-04-1) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1R)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-SBSPUUFOSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1R)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-SBSPUUFOSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)