Products 1935039-01-2
CAS 1935039-01-2 is the registry number for 6'-Chloro-3',4'-dihydro-2'H-spiro[azetidine-2,1'-naphthalene], 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chlorospiro[2,3-dihydro-1H-naphthalene-4,2'-azetidine] (CAS 1935039-01-2) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,2'-azetidine]. InChIKey: CQBWVKFPGVBMPD-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 7-chlorospiro[2,3-dihydro-1H-naphthalene-4,2'-azetidine] |
| InChIKey | CQBWVKFPGVBMPD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C3(C1)CCN3 |
Computed by PubChem (NCBI)