cas: 926641-28-3 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-2-(3-chlorophenyl)acetic acid, 95%, 95% (CAS 926641-28-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11730L-5g |
| cas | 926641-28-3 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1283.60 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 926641-28-3) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: (2R)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BGMKFLAFNZFBBB-SNVBAGLBSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | (2R)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BGMKFLAFNZFBBB-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)