Products 879088-65-0

CAS 879088-65-0 is the registry number for 4-((Boc-amino)methyl)-2-chlorobenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid (CAS 879088-65-0) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: 2-chloro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid. InChIKey: NEUYKPFEHZYUEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16ClNO4
Molecular weight285.72 g/mol
IUPAC name2-chloro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid
InChIKeyNEUYKPFEHZYUEQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1=CC(=C(C=C1)C(=O)O)Cl

Computed by PubChem (NCBI)