CAS 1637453-74-7 appears in our catalog under these names: (R)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine Hydrochloride, (R)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%, (R)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: TRC, Chemat, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g.
(1R)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637453-74-7) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: (1R)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: ILVJAIVQJZWBAB-SBSPUUFOSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | (1R)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | ILVJAIVQJZWBAB-SBSPUUFOSA-N |
| SMILES | C1CC2=CC(=C(C=C2[C@@H]1N)F)F.Cl |
Computed by PubChem (NCBI)