Products 2061980-60-5
CAS 2061980-60-5 appears in our catalog under these names: 4,7-Difluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 4，7–Difluoro–2，3–dihydro–1H–inden–1–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
4,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2061980-60-5) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 4,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: LDDUEFIEZUPIDT-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 4,7-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | LDDUEFIEZUPIDT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2C1N)F)F.Cl |
Computed by PubChem (NCBI)