CAS 1260870-03-8 appears in our catalog under these names: 3-(2,3-Difluorophenyl)azetidine, 95%, 3-(2,3-Difluorophenyl)azetidine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-(2,3-difluorophenyl)azetidine;hydrochloride (CAS 1260870-03-8) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 3-(2,3-difluorophenyl)azetidine;hydrochloride. InChIKey: BWWAGMWFOHOZLC-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 3-(2,3-difluorophenyl)azetidine;hydrochloride |
| InChIKey | BWWAGMWFOHOZLC-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=C(C(=CC=C2)F)F.Cl |
Computed by PubChem (NCBI)