CAS 1029689-74-4 appears in our catalog under these names: (S)-5,6-Difluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, (S)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride 95%, (S)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%, 95%, (S)-5,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(1S)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1029689-74-4) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: (1S)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: ILVJAIVQJZWBAB-FVGYRXGTSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | (1S)-5,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | ILVJAIVQJZWBAB-FVGYRXGTSA-N |
| SMILES | C1CC2=CC(=C(C=C2[C@H]1N)F)F.Cl |
Computed by PubChem (NCBI)