CAS 1199782-88-1 appears in our catalog under these names: 4,6-Difluoro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 4,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 4,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride 97%, 4,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%, 97%, 4,6-Difluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 0,5g.
4,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1199782-88-1) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 4,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NTWCYLYQLQQWBQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 4,6-difluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NTWCYLYQLQQWBQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2F)F.Cl |
Computed by PubChem (NCBI)