Products 1269188-75-1
CAS 1269188-75-1 appears in our catalog under these names: 1–(3，5–difluorophenyl)cyclopropan–1–amine hydrochloride, 1-(3,5-Difluorophenyl)cyclopropanamine hydrochloride, 95+%, [1-(3,5-difluorophenyl)cyclopropyl]amine hydrochloride, [1-(3,5-Difluorophenyl)cyclopropyl]amine hydrochloride, 95%. Offered by: GLPBio, AmBeed, Chemat, Combi-blocks. Available pack sizes: 1g, 500mg, 5g, 100mg, 250mg.
1-(3,5-difluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1269188-75-1) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 1-(3,5-difluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: MVDPVMYWNRXRSD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | MVDPVMYWNRXRSD-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)