CAS 1186663-16-0 appears in our catalog under these names: 1-(3,4-Difluorophenyl)cyclopropylamine hydrochloride, 98%, 1–(3,4–difluorophenyl)cyclopropan–1–amine hydrochloride, 1-(3,4-Difluorophenyl)cyclopropanamine hydrochloride 98%, 1-(3,4-Difluorophenyl)cyclopropanamine hydrochloride, 97%, 97%, 1-(3,4-Difluorophenyl)cyclopropanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
1-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1186663-16-0) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 1-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: BKORYOMJPYTNMW-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | BKORYOMJPYTNMW-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)F)F)N.Cl |
Computed by PubChem (NCBI)