Products 1269397-45-6
CAS 1269397-45-6 appears in our catalog under these names: [1-(2,5-Difluorophenyl)cyclopropyl]amine hydrochloride, 95%, 1–(2，5–difluorophenyl)cyclopropan–1–amine hydrochloride, [1-(2,5-difluorophenyl)cyclopropyl]amine hydrochloride. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, 500mg, 50mg.
1-(2,5-difluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1269397-45-6) is a chemical compound with the molecular formula C9H10ClF2N and a molecular weight of 205.63 g/mol. IUPAC name: 1-(2,5-difluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: MTWFPMFGBBLPNM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2N |
|---|---|
| Molecular weight | 205.63 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | MTWFPMFGBBLPNM-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)