(R)-Methyl 2,5-diamino-5-oxopentanoate hydrochloride, 95%, 95%
cas: 74817-54-2 — see every product listed under this CAS number, including other names
(R)-Methyl 2,5-diamino-5-oxopentanoate hydrochloride, 95%, 95% (CAS 74817-54-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3TC-5g |
| cas | 74817-54-2 |
| size | 5g |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 1792.40 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 506.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 74817-54-2) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-PGMHMLKASA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | HGYBXODOMJPMNO-PGMHMLKASA-N |
| SMILES | COC(=O)[C@@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-Glutamine methyl ester hydrochloride, (R)-methyl 2,5-diamino-5-oxopentanoate hydrochloride, D-GLUTAMINE METHYL ESTER HCL, methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride, (r)-2-amino-4-carbamoyl-butyric acid methyl ester, hcl, Methyl d-glutaminate, Methyl D-Glutaminate Hydrochloride, H-D-GLN-OME HCL, D-Glutamine, methyl ester, monohydrochloride, MethylD-glutaminatehydrochloride