cas: 74817-54-2 — see every product listed under this CAS number, including other names
D-Glutamine methyl ester hydrochloride, 95% (CAS 74817-54-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F011754-250MG |
| cas | 74817-54-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1684.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 74817-54-2) is a chemical compound with the molecular formula C6H13ClN2O3 and a molecular weight of 196.63 g/mol. IUPAC name: methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: HGYBXODOMJPMNO-PGMHMLKASA-N.
| Molecular formula | C6H13ClN2O3 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | methyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | HGYBXODOMJPMNO-PGMHMLKASA-N |
| SMILES | COC(=O)[C@@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)