cas: 127273-06-7 — see every product listed under this CAS number, including other names
(S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–cyanopropanoic acid (CAS 127273-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51742-100 |
| cas | 127273-06-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 512.79 Pln | |
| GLPBio | 10g | 2328.82 Pln | |
| GLPBio | 1g | 723.41 Pln | |
| GLPBio | 250mg | 531.51 Pln | |
| GLPBio | 5g | 1388.04 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 127273-06-7) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FJSOTHAUCCEZLI-KRWDZBQOSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FJSOTHAUCCEZLI-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC#N)C(=O)O |
Computed by PubChem (NCBI)