cas: 127273-06-7 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-cyanopropanoic acid, 98%, 98% (CAS 127273-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WTL-250mg |
| cas | 127273-06-7 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 10g | 1528.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 127273-06-7) is a chemical compound with the molecular formula C19H16N2O4 and a molecular weight of 336.3 g/mol. IUPAC name: (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: FJSOTHAUCCEZLI-KRWDZBQOSA-N.
| Molecular formula | C19H16N2O4 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2S)-3-cyano-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | FJSOTHAUCCEZLI-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC#N)C(=O)O |
Computed by PubChem (NCBI)