cas: 167993-00-2 — see every product listed under this CAS number, including other names
(S)–2–((tert–Butoxycarbonyl)amino)–3–(2,4–difluorophenyl)propanoic acid (CAS 167993-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GB51814-100 |
| cas | 167993-00-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 517.47 Pln | |
| GLPBio | 1g | 1079.13 Pln | |
| GLPBio | 250mg | 648.53 Pln | |
| GLPBio | 5g | 2403.71 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-3-(2,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 167993-00-2) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2S)-3-(2,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JNELGIOSRKVOJY-NSHDSACASA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2S)-3-(2,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JNELGIOSRKVOJY-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=C(C=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)