CAS 1214041-87-8 is the registry number for 2-[(tert-Butoxycarbonyl)amino]-3-(3,4-difluorophenyl)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1214041-87-8) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: 3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CYAOPVHXASZUDE-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CYAOPVHXASZUDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)