CAS 261380-31-8 appears in our catalog under these names: Boc-2,5-difluoro-d-phenylalanine, 97%, Boc–2,5–difluoro–D–phenylalanine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2R)-3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 261380-31-8) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DYSZJZJRRBKIDS-LLVKDONJSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DYSZJZJRRBKIDS-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=C(C=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)