CAS 205445-53-0 appears in our catalog under these names: Boc-D-3,5-difluorophenylalanine, 97%, Boc–D–3,5–Difluorophenylalanine, Boc-D-3,5-Difluorophenylalanine, 98%, 98%, Boc-D-3,5-Difluorophenylalanine, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
(2R)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-53-0) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CZBNUDVCRKSYDG-LLVKDONJSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CZBNUDVCRKSYDG-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)