CAS 205445-51-8 appears in our catalog under these names: Boc-D-Phe(3,4-DiF)-OH, Boc–3,4–Difluoro–D–Phenylalanine, Boc-D-Phe(3,4-F2)-OH, Boc-D-Phe(3,4-DiF)-OH, 98%, 98%, Boc-D-Phe(3,4-DiF)-OH, 98.04%. Offered by: TargetMol, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 50mg, 10g, 25g, 5g, 100mg, 250mg, 1g, 5 g.
(2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-51-8) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CYAOPVHXASZUDE-LLVKDONJSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CYAOPVHXASZUDE-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)