CAS 2660255-62-7 is the registry number for rel-Benzyl (4R,5R)-3,3-difluoro-5-hydroxy-4-methoxypiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (4R,5R)-3,3-difluoro-5-hydroxy-4-methoxypiperidine-1-carboxylate (CAS 2660255-62-7) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: benzyl (4R,5R)-3,3-difluoro-5-hydroxy-4-methoxypiperidine-1-carboxylate. InChIKey: UJIHDNYJVJARDQ-VXGBXAGGSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | benzyl (4R,5R)-3,3-difluoro-5-hydroxy-4-methoxypiperidine-1-carboxylate |
| InChIKey | UJIHDNYJVJARDQ-VXGBXAGGSA-N |
| SMILES | CO[C@@H]1[C@@H](CN(CC1(F)F)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)