CAS 486460-02-0 appears in our catalog under these names: N-Boc-2,5-difluoro-dl-phenylalanine, 95%, 2–((tert–Butoxycarbonyl)amino)–3–(2,5–difluorophenyl)propanoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g.
3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 486460-02-0) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: 3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DYSZJZJRRBKIDS-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DYSZJZJRRBKIDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=C(C=CC(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)