CAS 1022147-21-2 is the registry number for (R)-2-((tert-Butoxycarbonyl)amino)-3-(2,3-difluorophenyl)propanoic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-3-(2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1022147-21-2) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MMZBMRZQYLJCOE-SNVBAGLBSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MMZBMRZQYLJCOE-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=C(C(=CC=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)