cas: 2055848-81-0 — see every product listed under this CAS number, including other names
(S)-1-(2,6-Dichlorophenyl)ethanamine hydrochloride, 96% (CAS 2055848-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F692907-100MG |
| cas | 2055848-81-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 320.74 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride (CAS 2055848-81-0) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride. InChIKey: QBWKCUFYMDZATP-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(2,6-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | QBWKCUFYMDZATP-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=C(C=CC=C1Cl)Cl)N.Cl |
Computed by PubChem (NCBI)