cas: 1788072-43-4 — see every product listed under this CAS number, including other names
(S)-1-(3,5-Dichlorophenyl)ethanamine hydrochloride 98% (CAS 1788072-43-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1192265-100mg |
| cas | 1788072-43-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1271.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1192265 |
(1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride (CAS 1788072-43-4) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: (1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: YKPAICVWOBWQTG-JEDNCBNOSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | (1S)-1-(3,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | YKPAICVWOBWQTG-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)