CAS 321318-36-9 appears in our catalog under these names: 1-(3,5-Dichlorophenyl)ethylamine hydrochloride, 95%, 1-(3,5-Dichlorophenyl)ethylamine Hydrochloride, 98%, 98%, 1-(3,5-Dichlorophenyl)ethan-1-amine hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g.
1-(3,5-dichlorophenyl)ethanamine;hydrochloride (CAS 321318-36-9) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: YKPAICVWOBWQTG-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | YKPAICVWOBWQTG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)