cas: 84499-78-5 — see every product listed under this CAS number, including other names
(S)-1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride 95% (CAS 84499-78-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A663326-100mg |
| cas | 84499-78-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 3952.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A663326 |
(1S)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 84499-78-5) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: (1S)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: JVLWNYKROJNLAS-RGMNGODLSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | (1S)-1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | JVLWNYKROJNLAS-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)