cas: 51600-24-9 — see every product listed under this CAS number, including other names
(S)-1-(Naphthalen-1-yl)ethanamine hydrochloride 96% (CAS 51600-24-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A610648-250mg |
| cas | 51600-24-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 10g | 1076.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A610648 |
(1S)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 51600-24-9) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1S)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-FVGYRXGTSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1S)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)