cas: 51600-24-9 — see every product listed under this CAS number, including other names
(S)-1-(Naphthalen-1-yl)ethanamine hydrochloride, 96% (CAS 51600-24-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 10g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F738004-5G |
| cas | 51600-24-9 |
| size | 5g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1226.67 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 631.81 Pln | |
| Ambeed | 10g | 1188.06 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 675.34 Pln | |
| BLDpharm | 10g | 1275.13 Pln |
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(1S)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 51600-24-9) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1S)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-FVGYRXGTSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1S)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)