cas: 117836-13-2 — see every product listed under this CAS number, including other names
(S)-1-Benzyl 2-methyl 5-oxopiperidine-1,2-dicarboxylate, 97%, 97% (CAS 117836-13-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HE0R-100mg |
| cas | 117836-13-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1610.00 Pln | |
| Chemat | 1g | 2334.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-benzyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate (CAS 117836-13-2) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate. InChIKey: HFKHJRQXLOFHNO-ZDUSSCGKSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2S)-5-oxopiperidine-1,2-dicarboxylate |
| InChIKey | HFKHJRQXLOFHNO-ZDUSSCGKSA-N |
| SMILES | COC(=O)[C@@H]1CCC(=O)CN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)