CAS 1793077-74-3 is the registry number for 2-tert-Butyl 5-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate (CAS 1793077-74-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate. InChIKey: ZEYIEXKZXUDEFQ-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate |
| InChIKey | ZEYIEXKZXUDEFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1=O)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)