Products 1793077-74-3

CAS 1793077-74-3 is the registry number for 2-tert-Butyl 5-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate (CAS 1793077-74-3) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate. InChIKey: ZEYIEXKZXUDEFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO5
Molecular weight291.30 g/mol
IUPAC name2-O-tert-butyl 5-O-methyl 1-oxo-3H-isoindole-2,5-dicarboxylate
InChIKeyZEYIEXKZXUDEFQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2=C(C1=O)C=CC(=C2)C(=O)OC

Computed by PubChem (NCBI)