Products 797801-61-7

CAS 797801-61-7 is the registry number for 1-Cbz-5-oxo-piperidine-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

1-O-benzyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate (CAS 797801-61-7) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate. InChIKey: HFKHJRQXLOFHNO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO5
Molecular weight291.30 g/mol
IUPAC name1-O-benzyl 2-O-methyl 5-oxopiperidine-1,2-dicarboxylate
InChIKeyHFKHJRQXLOFHNO-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(=O)CN1C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)