cas: 1217603-41-2 — see every product listed under this CAS number, including other names
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxy-3-methylbutanoic acid, 98%, 98% (CAS 1217603-41-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126TM-50g |
| cas | 1217603-41-2 |
| size | 50g |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 3006.80 Pln | |
| Chemat | 100g | 4850.00 Pln | |
| Chemat | 250g | 9285.20 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 957.20 Pln | |
| Chemat | 25g | 2128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid (CAS 1217603-41-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid. InChIKey: KIOMNBRJPAICIT-QGZVFWFLSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid |
| InChIKey | KIOMNBRJPAICIT-QGZVFWFLSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)