cas: 1217603-41-2 — see every product listed under this CAS number, including other names
FMOC-(S)-2-Amino-3-hydroxy-3-methylbutanoic acid, 95% (CAS 1217603-41-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387498-100MG |
| cas | 1217603-41-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Fluorochem | 10g | 1513.03 Pln | |
| Fluorochem | 25g | 3158.28 Pln | |
| Fluorochem | 100g | 8307.51 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid (CAS 1217603-41-2) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid. InChIKey: KIOMNBRJPAICIT-QGZVFWFLSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid |
| InChIKey | KIOMNBRJPAICIT-QGZVFWFLSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)