(S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester, HCl, ≥97%, ≥97%
cas: 457654-69-2 — see every product listed under this CAS number, including other names
(S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester, HCl, ≥97%, ≥97% (CAS 457654-69-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9JC-1g |
| cas | 457654-69-2 |
| size | 1g |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1638.80 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 25g | 5574.80 Pln |
properties
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride (CAS 457654-69-2) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride. InChIKey: QTBXLWIDAKRUBJ-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride |
| InChIKey | QTBXLWIDAKRUBJ-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 2-amino-3-(2-fluorophenyl)propanoate hydrochloride, 2-Fluoro-L-phenylalanine methyl ester hydrochloride, methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride, Methyl (S)-2-amino-3-(2-fluorophenyl)propanoate hydrochloride, (S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester hydrochloride, 2-Fluoro-L-phenylalanine methyl ester HCl, (S)-Methyl2-amino-3-(2-fluorophenyl)propanoatehydrochloride, (S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester, hydrochloride