CAS 331763-62-3 appears in our catalog under these names: 2-Fluoro-d-beta-homophenylalanine hydrochloride, 95%, (R)-3-Amino-4-(2-fluorophenyl)butanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(3R)-3-amino-4-(2-fluorophenyl)butanoic acid;hydrochloride (CAS 331763-62-3) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: (3R)-3-amino-4-(2-fluorophenyl)butanoic acid;hydrochloride. InChIKey: JZQZLHARRLTFJX-DDWIOCJRSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | (3R)-3-amino-4-(2-fluorophenyl)butanoic acid;hydrochloride |
| InChIKey | JZQZLHARRLTFJX-DDWIOCJRSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)N)F.Cl |
Computed by PubChem (NCBI)