CAS 270596-50-4 appears in our catalog under these names: (S)-3-Amino-4-(3-fluorophenyl)butanoic acid hydrochloride, 97%, H-β-HoPhe(3-F)-OH, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3S)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride (CAS 270596-50-4) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: (3S)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride. InChIKey: HLJRPTAKNOUJAW-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | (3S)-3-amino-4-(3-fluorophenyl)butanoic acid;hydrochloride |
| InChIKey | HLJRPTAKNOUJAW-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC(=C1)F)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)