CAS 457654-69-2 appears in our catalog under these names: (S)-Methyl 2-amino-3-(2-fluorophenyl)propanoate hydrochloride, 97%, (S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester hydrochloride, 97%, (S)-2-Amino-3-(2-fluoro-phenyl)-propionic acid methyl ester, HCl, ≥97%, ≥97%. Offered by: AmBeed, Combi-blocks, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg.
Methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride (CAS 457654-69-2) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride. InChIKey: QTBXLWIDAKRUBJ-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(2-fluorophenyl)propanoate;hydrochloride |
| InChIKey | QTBXLWIDAKRUBJ-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1F)N.Cl |
Computed by PubChem (NCBI)